C15H12Br2O3 — CID 107738219
3,5-dibromo-4-(phenylmethoxymethoxy)benzaldehyde (PubChem CID 107738219) has the molecular formula C15H12Br2O3 and a molecular weight of 400.07 g/mol. Its IUPAC name is 3,5-dibromo-4-(phenylmethoxymethoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(phenylmethoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 107738219 |
| Molecular Formula | C15H12Br2O3 |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 3,5-dibromo-4-(phenylmethoxymethoxy)benzaldehyde |
| SMILES | O=Cc1cc(Br)c(OCOCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2O3/c16-13-6-12(8-18)7-14(17)15(13)20-10-19-9-11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | ANNMBIOGNRRFJZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|