C12H12Br2O3 — CID 107738292
3,5-dibromo-4-(cyclopropylmethoxymethoxy)benzaldehyde (PubChem CID 107738292) has the molecular formula C12H12Br2O3 and a molecular weight of 364.03 g/mol. Its IUPAC name is 3,5-dibromo-4-(cyclopropylmethoxymethoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(cyclopropylmethoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 107738292 |
| Molecular Formula | C12H12Br2O3 |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 3,5-dibromo-4-(cyclopropylmethoxymethoxy)benzaldehyde |
| SMILES | O=Cc1cc(Br)c(OCOCC2CC2)c(Br)c1 |
| InChI | InChI=1S/C12H12Br2O3/c13-10-3-9(5-15)4-11(14)12(10)17-7-16-6-8-1-2-8/h3-5,8H,1-2,6-7H2 |
| InChIKey | UPSWDPMCLDXFDP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|