C12H12Br2O2 — CID 107738345
3,5-dibromo-4-cyclopentyloxybenzaldehyde (PubChem CID 107738345) has the molecular formula C12H12Br2O2 and a molecular weight of 348.03 g/mol. Its IUPAC name is 3,5-dibromo-4-cyclopentyloxybenzaldehyde.
| Compound Name | 3,5-dibromo-4-cyclopentyloxybenzaldehyde |
|---|---|
| PubChem CID | 107738345 |
| Molecular Formula | C12H12Br2O2 |
| Molecular Weight | 348.03 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 3,5-dibromo-4-cyclopentyloxybenzaldehyde |
| SMILES | O=Cc1cc(Br)c(OC2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C12H12Br2O2/c13-10-5-8(7-15)6-11(14)12(10)16-9-3-1-2-4-9/h5-7,9H,1-4H2 |
| InChIKey | CSUMFJVYPXWRBR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.03 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|