C16H13BrF2O2 — CID 106264128
4-[(3-bromo-2,6-difluorophenyl)methoxy]-3,5-dimethylbenzaldehyde (PubChem CID 106264128) has the molecular formula C16H13BrF2O2 and a molecular weight of 355.18 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methoxy]-3,5-dimethylbenzaldehyde.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methoxy]-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 106264128 |
| Molecular Formula | C16H13BrF2O2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methoxy]-3,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1OCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C16H13BrF2O2/c1-9-5-11(7-20)6-10(2)16(9)21-8-12-14(18)4-3-13(17)15(12)19/h3-7H,8H2,1-2H3 |
| InChIKey | CLLIDOSUMYLPFA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|