C11H7Br2NO3 — CID 107738404
3,5-dibromo-4-(1,2-oxazol-5-ylmethoxy)benzaldehyde (PubChem CID 107738404) has the molecular formula C11H7Br2NO3 and a molecular weight of 360.99 g/mol. Its IUPAC name is 3,5-dibromo-4-(1,2-oxazol-5-ylmethoxy)benzaldehyde.
| Compound Name | 3,5-dibromo-4-(1,2-oxazol-5-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 107738404 |
| Molecular Formula | C11H7Br2NO3 |
| Molecular Weight | 360.99 g/mol |
| Exact Mass | 358.88 |
| IUPAC Name | 3,5-dibromo-4-(1,2-oxazol-5-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1cc(Br)c(OCc2ccno2)c(Br)c1 |
| InChI | InChI=1S/C11H7Br2NO3/c12-9-3-7(5-15)4-10(13)11(9)16-6-8-1-2-14-17-8/h1-5H,6H2 |
| InChIKey | AYYIRRBVQHDFDN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.99 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|