C15H8Br2F3NO3 — CID 28913545
2-(2,6-dibromo-4-formylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 28913545) has the molecular formula C15H8Br2F3NO3 and a molecular weight of 467.04 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-formylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(2,6-dibromo-4-formylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 28913545 |
| Molecular Formula | C15H8Br2F3NO3 |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 464.88 |
| IUPAC Name | 2-(2,6-dibromo-4-formylphenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=Cc1cc(Br)c(OCC(=O)Nc2ccc(F)c(F)c2F)c(Br)c1 |
| InChI | InChI=1S/C15H8Br2F3NO3/c16-8-3-7(5-22)4-9(17)15(8)24-6-12(23)21-11-2-1-10(18)13(19)14(11)20/h1-5H,6H2,(H,21,23) |
| InChIKey | BLXFCIGHHYZEMU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|