C15H9Cl4NO3 — CID 28913451
2-(2,6-dichloro-4-formylphenoxy)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 28913451) has the molecular formula C15H9Cl4NO3 and a molecular weight of 393.05 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-formylphenoxy)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(2,6-dichloro-4-formylphenoxy)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 28913451 |
| Molecular Formula | C15H9Cl4NO3 |
| Molecular Weight | 393.05 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 2-(2,6-dichloro-4-formylphenoxy)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | O=Cc1cc(Cl)c(OCC(=O)Nc2cc(Cl)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl4NO3/c16-9-1-2-10(17)13(5-9)20-14(22)7-23-15-11(18)3-8(6-21)4-12(15)19/h1-6H,7H2,(H,20,22) |
| InChIKey | SJVMTPDBRVTNGN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.05 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|