C10H8BrF4NO2 — CID 63999855
2-(4-bromo-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 63999855) has the molecular formula C10H8BrF4NO2 and a molecular weight of 330.08 g/mol. Its IUPAC name is 2-(4-bromo-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-bromo-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 63999855 |
| Molecular Formula | C10H8BrF4NO2 |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 2-(4-bromo-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(COc1ccc(Br)c(F)c1)NCC(F)(F)F |
| InChI | InChI=1S/C10H8BrF4NO2/c11-7-2-1-6(3-8(7)12)18-4-9(17)16-5-10(13,14)15/h1-3H,4-5H2,(H,16,17) |
| InChIKey | OJBMJKTZFMQIKX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |