C10H8Br2F3NO2 — CID 47449431
2-(2,6-dibromophenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 47449431) has the molecular formula C10H8Br2F3NO2 and a molecular weight of 390.98 g/mol. Its IUPAC name is 2-(2,6-dibromophenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2,6-dibromophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 47449431 |
| Molecular Formula | C10H8Br2F3NO2 |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 388.89 |
| IUPAC Name | 2-(2,6-dibromophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(COc1c(Br)cccc1Br)NCC(F)(F)F |
| InChI | InChI=1S/C10H8Br2F3NO2/c11-6-2-1-3-7(12)9(6)18-4-8(17)16-5-10(13,14)15/h1-3H,4-5H2,(H,16,17) |
| InChIKey | KQXABHVKJSWTCA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |