C14H13Br2NO2S — CID 47449504
2-(2,6-dibromophenoxy)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 47449504) has the molecular formula C14H13Br2NO2S and a molecular weight of 419.14 g/mol. Its IUPAC name is 2-(2,6-dibromophenoxy)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2,6-dibromophenoxy)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 47449504 |
| Molecular Formula | C14H13Br2NO2S |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 416.90 |
| IUPAC Name | 2-(2,6-dibromophenoxy)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(COc1c(Br)cccc1Br)NCCc1cccs1 |
| InChI | InChI=1S/C14H13Br2NO2S/c15-11-4-1-5-12(16)14(11)19-9-13(18)17-7-6-10-3-2-8-20-10/h1-5,8H,6-7,9H2,(H,17,18) |
| InChIKey | XGZBSZQVZKQILH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |