C16H16BrNO4S — CID 8951230
2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 8951230) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 8951230 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | COc1cc(Br)c(C=O)cc1OCC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C16H16BrNO4S/c1-21-14-8-13(17)11(9-19)7-15(14)22-10-16(20)18-5-4-12-3-2-6-23-12/h2-3,6-9H,4-5,10H2,1H3,(H,18,20) |
| InChIKey | KJJDVTHDHWJXDS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|