C11H8F4N2O2 — CID 78952816
2-(4-cyano-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 78952816) has the molecular formula C11H8F4N2O2 and a molecular weight of 276.19 g/mol. Its IUPAC name is 2-(4-cyano-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-cyano-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 78952816 |
| Molecular Formula | C11H8F4N2O2 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-(4-cyano-3-fluorophenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | N#Cc1ccc(OCC(=O)NCC(F)(F)F)cc1F |
| InChI | InChI=1S/C11H8F4N2O2/c12-9-3-8(2-1-7(9)4-16)19-5-10(18)17-6-11(13,14)15/h1-3H,5-6H2,(H,17,18) |
| InChIKey | JVJZXCCFXPMVAJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |