C30H18F10O5 — CID 157338042
2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetaldehyde;ethyl 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetate (PubChem CID 157338042) has the molecular formula C30H18F10O5 and a molecular weight of 648.45 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetaldehyde;ethyl 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetate.
| Compound Name | 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetaldehyde;ethyl 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 157338042 |
| Molecular Formula | C30H18F10O5 |
| Molecular Weight | 648.45 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetaldehyde;ethyl 2,2-difluoro-2-[4-(3,4,5-trifluorophenyl)phenoxy]acetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc(-c2cc(F)c(F)c(F)c2)cc1.O=CC(F)(F)Oc1ccc(-c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H11F5O3.C14H7F5O2/c1-2-23-15(22)16(20,21)24-11-5-3-9(4-6-11)10-7-12(17)14(19)13(18)8-10;15-11-5-9(6-12(16)13(11)17)8-1-3-10(4-2-8)21-14(18,19)7-20/h3-8H,2H2,1H3;1-7H |
| InChIKey | BGBMKESAQXWITL-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.45 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|