C17H13FN4O4S — CID 169401945
ethyl 5-[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]-2H-triazole-4-carboxylate (PubChem CID 169401945) has the molecular formula C17H13FN4O4S and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 5-[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401945 |
| Molecular Formula | C17H13FN4O4S |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | ethyl 5-[2-(4-fluorophenyl)sulfanyl-5-nitrophenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc([N+](=O)[O-])ccc1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN4O4S/c1-2-26-17(23)16-15(19-21-20-16)13-9-11(22(24)25)5-8-14(13)27-12-6-3-10(18)4-7-12/h3-9H,2H2,1H3,(H,19,20,21) |
| InChIKey | FKHHBVJIQXHIIG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|