C11H9BrN4O4 — CID 169399207
ethyl 5-(2-bromo-5-nitrophenyl)-2H-triazole-4-carboxylate (PubChem CID 169399207) has the molecular formula C11H9BrN4O4 and a molecular weight of 341.12 g/mol. Its IUPAC name is ethyl 5-(2-bromo-5-nitrophenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-bromo-5-nitrophenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399207 |
| Molecular Formula | C11H9BrN4O4 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | ethyl 5-(2-bromo-5-nitrophenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C11H9BrN4O4/c1-2-20-11(17)10-9(13-15-14-10)7-5-6(16(18)19)3-4-8(7)12/h3-5H,2H2,1H3,(H,13,14,15) |
| InChIKey | YFZKNSAXCASOGA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|