C11H9ClFN3O2 — CID 169399029
ethyl 5-(2-chloro-4-fluorophenyl)-2H-triazole-4-carboxylate (PubChem CID 169399029) has the molecular formula C11H9ClFN3O2 and a molecular weight of 269.66 g/mol. Its IUPAC name is ethyl 5-(2-chloro-4-fluorophenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-chloro-4-fluorophenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399029 |
| Molecular Formula | C11H9ClFN3O2 |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | ethyl 5-(2-chloro-4-fluorophenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H9ClFN3O2/c1-2-18-11(17)10-9(14-16-15-10)7-4-3-6(13)5-8(7)12/h3-5H,2H2,1H3,(H,14,15,16) |
| InChIKey | JECSEEVOKQYRDL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |