C12H9F3IN3O3 — CID 169401462
ethyl 5-[4-iodo-3-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401462) has the molecular formula C12H9F3IN3O3 and a molecular weight of 427.12 g/mol. Its IUPAC name is ethyl 5-[4-iodo-3-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-iodo-3-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401462 |
| Molecular Formula | C12H9F3IN3O3 |
| Molecular Weight | 427.12 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | ethyl 5-[4-iodo-3-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(I)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F3IN3O3/c1-2-21-11(20)10-9(17-19-18-10)6-3-4-7(16)8(5-6)22-12(13,14)15/h3-5H,2H2,1H3,(H,17,18,19) |
| InChIKey | DSIBLSBQGIFHGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|