C10H6F4N4O2 — CID 169403613
5-[5-fluoro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403613) has the molecular formula C10H6F4N4O2 and a molecular weight of 290.18 g/mol. Its IUPAC name is 5-[5-fluoro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[5-fluoro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403613 |
| Molecular Formula | C10H6F4N4O2 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 5-[5-fluoro-2-(trifluoromethoxy)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C10H6F4N4O2/c11-4-1-2-6(20-10(12,13)14)5(3-4)7-8(9(15)19)17-18-16-7/h1-3H,(H2,15,19)(H,16,17,18) |
| InChIKey | CTDYTXXDGYKJCN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |