C9H5F3N4O — CID 169402152
5-(2,4,5-trifluorophenyl)-2H-triazole-4-carboxamide (PubChem CID 169402152) has the molecular formula C9H5F3N4O and a molecular weight of 242.16 g/mol. Its IUPAC name is 5-(2,4,5-trifluorophenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(2,4,5-trifluorophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402152 |
| Molecular Formula | C9H5F3N4O |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 5-(2,4,5-trifluorophenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H5F3N4O/c10-4-2-6(12)5(11)1-3(4)7-8(9(13)17)15-16-14-7/h1-2H,(H2,13,17)(H,14,15,16) |
| InChIKey | HKYFSTICFVWACM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|