C10H8BrFN4O2 — CID 169404864
5-(3-bromo-4-fluoro-2-methoxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 169404864) has the molecular formula C10H8BrFN4O2 and a molecular weight of 315.10 g/mol. Its IUPAC name is 5-(3-bromo-4-fluoro-2-methoxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3-bromo-4-fluoro-2-methoxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404864 |
| Molecular Formula | C10H8BrFN4O2 |
| Molecular Weight | 315.10 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 5-(3-bromo-4-fluoro-2-methoxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | COc1c(-c2n[nH]nc2C(N)=O)ccc(F)c1Br |
| InChI | InChI=1S/C10H8BrFN4O2/c1-18-9-4(2-3-5(12)6(9)11)7-8(10(13)17)15-16-14-7/h2-3H,1H3,(H2,13,17)(H,14,15,16) |
| InChIKey | ILJVNPIDPAJIIQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.10 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |