C10H9FN4O3 — CID 169404852
5-(5-fluoro-2-hydroxy-3-methoxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 169404852) has the molecular formula C10H9FN4O3 and a molecular weight of 252.21 g/mol. Its IUPAC name is 5-(5-fluoro-2-hydroxy-3-methoxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(5-fluoro-2-hydroxy-3-methoxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404852 |
| Molecular Formula | C10H9FN4O3 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-(5-fluoro-2-hydroxy-3-methoxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | COc1cc(F)cc(-c2n[nH]nc2C(N)=O)c1O |
| InChI | InChI=1S/C10H9FN4O3/c1-18-6-3-4(11)2-5(9(6)16)7-8(10(12)17)14-15-13-7/h2-3,16H,1H3,(H2,12,17)(H,13,14,15) |
| InChIKey | HQKHVJHLLIFBBL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |