C12H12F2N4O2 — CID 169404803
5-(5-ethoxy-2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxamide (PubChem CID 169404803) has the molecular formula C12H12F2N4O2 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-(5-ethoxy-2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(5-ethoxy-2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404803 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-(5-ethoxy-2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxamide |
| SMILES | CCOc1cc(-c2n[nH]nc2C(N)=O)c(F)c(F)c1C |
| InChI | InChI=1S/C12H12F2N4O2/c1-3-20-7-4-6(9(14)8(13)5(7)2)10-11(12(15)19)17-18-16-10/h4H,3H2,1-2H3,(H2,15,19)(H,16,17,18) |
| InChIKey | PLWXPSSLLGLPOX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |