C16H11F3N4O2 — CID 169403087
5-[2-hydroxy-5-[4-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403087) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is 5-[2-hydroxy-5-[4-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-hydroxy-5-[4-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403087 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-[2-hydroxy-5-[4-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(-c2ccc(C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C16H11F3N4O2/c17-16(18,19)10-4-1-8(2-5-10)9-3-6-12(24)11(7-9)13-14(15(20)25)22-23-21-13/h1-7,24H,(H2,20,25)(H,21,22,23) |
| InChIKey | LUBDHEFPXJTVCR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |