C11H9F3N4O3S — CID 169403044
5-[2-methylsulfonyl-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403044) has the molecular formula C11H9F3N4O3S and a molecular weight of 334.28 g/mol. Its IUPAC name is 5-[2-methylsulfonyl-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-methylsulfonyl-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403044 |
| Molecular Formula | C11H9F3N4O3S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 5-[2-methylsulfonyl-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C(F)(F)F)cc1-c1n[nH]nc1C(N)=O |
| InChI | InChI=1S/C11H9F3N4O3S/c1-22(20,21)7-3-2-5(11(12,13)14)4-6(7)8-9(10(15)19)17-18-16-8/h2-4H,1H3,(H2,15,19)(H,16,17,18) |
| InChIKey | TZDHVQJWEHWDMV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |