C13H15N3O6S2 — CID 169401483
ethyl 5-[2,4-bis(methylsulfonyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401483) has the molecular formula C13H15N3O6S2 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl 5-[2,4-bis(methylsulfonyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[2,4-bis(methylsulfonyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401483 |
| Molecular Formula | C13H15N3O6S2 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | ethyl 5-[2,4-bis(methylsulfonyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C13H15N3O6S2/c1-4-22-13(17)12-11(14-16-15-12)9-6-5-8(23(2,18)19)7-10(9)24(3,20)21/h5-7H,4H2,1-3H3,(H,14,15,16) |
| InChIKey | IFNLKGINULHTHN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |