C9H11N5O2 — CID 165466424
ethyl 5-(5-methyl-1H-pyrazol-4-yl)-2H-triazole-4-carboxylate (PubChem CID 165466424) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is ethyl 5-(5-methyl-1H-pyrazol-4-yl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(5-methyl-1H-pyrazol-4-yl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 165466424 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | ethyl 5-(5-methyl-1H-pyrazol-4-yl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cn[nH]c1C |
| InChI | InChI=1S/C9H11N5O2/c1-3-16-9(15)8-7(12-14-13-8)6-4-10-11-5(6)2/h4H,3H2,1-2H3,(H,10,11)(H,12,13,14) |
| InChIKey | CMSQWZWKAIKYLK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |