C12H13N3O4S — CID 169398981
ethyl 5-(4-methylsulfonylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169398981) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is ethyl 5-(4-methylsulfonylphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(4-methylsulfonylphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169398981 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | ethyl 5-(4-methylsulfonylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13N3O4S/c1-3-19-12(16)11-10(13-15-14-11)8-4-6-9(7-5-8)20(2,17)18/h4-7H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | OESQIAGOAWAYNP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |