C15H13N3O2S — CID 169401570
ethyl 5-(4-thiophen-3-ylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401570) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is ethyl 5-(4-thiophen-3-ylphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(4-thiophen-3-ylphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401570 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | ethyl 5-(4-thiophen-3-ylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C15H13N3O2S/c1-2-20-15(19)14-13(16-18-17-14)11-5-3-10(4-6-11)12-7-8-21-9-12/h3-9H,2H2,1H3,(H,16,17,18) |
| InChIKey | NLAFUHVWLWGSNK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |