C16H22N4O2 — CID 169399671
ethyl 5-[4-(diethylaminomethyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169399671) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is ethyl 5-[4-(diethylaminomethyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-(diethylaminomethyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399671 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethyl 5-[4-(diethylaminomethyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(CN(CC)CC)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-4-20(5-2)11-12-7-9-13(10-8-12)14-15(18-19-17-14)16(21)22-6-3/h7-10H,4-6,11H2,1-3H3,(H,17,18,19) |
| InChIKey | HIZYBHBSILLCNP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |