C19H25N3O3 — CID 169399577
ethyl 5-[4-(cyclohexylmethoxymethyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169399577) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 5-[4-(cyclohexylmethoxymethyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-(cyclohexylmethoxymethyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399577 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | ethyl 5-[4-(cyclohexylmethoxymethyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(COCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-2-25-19(23)18-17(20-22-21-18)16-10-8-15(9-11-16)13-24-12-14-6-4-3-5-7-14/h8-11,14H,2-7,12-13H2,1H3,(H,20,21,22) |
| InChIKey | CBVTYECUYPKRLT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |