C23H26BN3O4 — CID 169401731
ethyl 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401731) has the molecular formula C23H26BN3O4 and a molecular weight of 419.29 g/mol. Its IUPAC name is ethyl 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401731 |
| Molecular Formula | C23H26BN3O4 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | ethyl 5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C23H26BN3O4/c1-6-29-21(28)20-19(25-27-26-20)17-9-7-15(8-10-17)16-11-13-18(14-12-16)24-30-22(2,3)23(4,5)31-24/h7-14H,6H2,1-5H3,(H,25,26,27) |
| InChIKey | GWRDRGHWPJTVQJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|