C15H20BN3O4 — CID 170634291
ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 170634291) has the molecular formula C15H20BN3O4 and a molecular weight of 317.15 g/mol. Its IUPAC name is ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170634291 |
| Molecular Formula | C15H20BN3O4 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1nnn2cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C15H20BN3O4/c1-6-21-13(20)12-11-8-7-10(9-19(11)18-17-12)16-22-14(2,3)15(4,5)23-16/h7-9H,6H2,1-5H3 |
| InChIKey | ZFBGWCSDGWYNRN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|