C20H26BNO5 — CID 58626697
ethyl 1-ethyl-4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate (PubChem CID 58626697) has the molecular formula C20H26BNO5 and a molecular weight of 371.24 g/mol. Its IUPAC name is ethyl 1-ethyl-4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate.
| Compound Name | ethyl 1-ethyl-4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 58626697 |
| Molecular Formula | C20H26BNO5 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | ethyl 1-ethyl-4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)c2ccc(B3OC(C)(C)C(C)(C)O3)cn2c1=O |
| InChI | InChI=1S/C20H26BNO5/c1-7-13-11-15(18(24)25-8-2)17(23)22-12-14(9-10-16(13)22)21-26-19(3,4)20(5,6)27-21/h9-12H,7-8H2,1-6H3 |
| InChIKey | YTEBMKKXPGRZMV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|