C30H48BNO6Si — CID 59784007
ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate (PubChem CID 59784007) has the molecular formula C30H48BNO6Si and a molecular weight of 557.61 g/mol. Its IUPAC name is ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 59784007 |
| Molecular Formula | C30H48BNO6Si |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H](CO[Si](C)(C)C(C)(C)C)C(C)(C)C)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2c1=O |
| InChI | InChI=1S/C30H48BNO6Si/c1-14-35-26(34)22-18-32(24(27(2,3)4)19-36-39(12,13)28(5,6)7)23-16-15-20(17-21(23)25(22)33)31-37-29(8,9)30(10,11)38-31/h15-18,24H,14,19H2,1-13H3/t24-/m1/s1 |
| InChIKey | XWLLNBUOIGNCSG-XMMPIXPASA-N |
| XLogP | 6.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|