C26H38BNO7S — CID 71028306
ethyl 1-[(2S)-3,3-dimethyl-1-methylsulfanyloxybutan-2-yl]-7-methoxy-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate (PubChem CID 71028306) has the molecular formula C26H38BNO7S and a molecular weight of 519.47 g/mol. Its IUPAC name is ethyl 1-[(2S)-3,3-dimethyl-1-methylsulfanyloxybutan-2-yl]-7-methoxy-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 1-[(2S)-3,3-dimethyl-1-methylsulfanyloxybutan-2-yl]-7-methoxy-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71028306 |
| Molecular Formula | C26H38BNO7S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | ethyl 1-[(2S)-3,3-dimethyl-1-methylsulfanyloxybutan-2-yl]-7-methoxy-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H](COSC)C(C)(C)C)c2cc(OC)c(B3OC(C)(C)C(C)(C)O3)cc2c1=O |
| InChI | InChI=1S/C26H38BNO7S/c1-11-32-23(30)17-14-28(21(15-33-36-10)24(2,3)4)19-13-20(31-9)18(12-16(19)22(17)29)27-34-25(5,6)26(7,8)35-27/h12-14,21H,11,15H2,1-10H3/t21-/m1/s1 |
| InChIKey | CEUOEIUQNMMVPV-OAQYLSRUSA-N |
| XLogP | 4.37 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|