C21H31NO5Si — CID 123645125
methyl 7-methoxy-6-methyl-1-(3-methyl-1-trimethylsilyloxybutan-2-yl)-4-oxoquinoline-3-carboxylate (PubChem CID 123645125) has the molecular formula C21H31NO5Si and a molecular weight of 405.57 g/mol. Its IUPAC name is methyl 7-methoxy-6-methyl-1-(3-methyl-1-trimethylsilyloxybutan-2-yl)-4-oxoquinoline-3-carboxylate.
| Compound Name | methyl 7-methoxy-6-methyl-1-(3-methyl-1-trimethylsilyloxybutan-2-yl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 123645125 |
| Molecular Formula | C21H31NO5Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | methyl 7-methoxy-6-methyl-1-(3-methyl-1-trimethylsilyloxybutan-2-yl)-4-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1cn(C(CO[Si](C)(C)C)C(C)C)c2cc(OC)c(C)cc2c1=O |
| InChI | InChI=1S/C21H31NO5Si/c1-13(2)18(12-27-28(6,7)8)22-11-16(21(24)26-5)20(23)15-9-14(3)19(25-4)10-17(15)22/h9-11,13,18H,12H2,1-8H3 |
| InChIKey | UHHMIDLQXALPLC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|