C22H33ClN2O4Si — CID 58334705
ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-chloro-4-oxo-1,7-naphthyridine-3-carboxylate (PubChem CID 58334705) has the molecular formula C22H33ClN2O4Si and a molecular weight of 453.06 g/mol. Its IUPAC name is ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-chloro-4-oxo-1,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-chloro-4-oxo-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 58334705 |
| Molecular Formula | C22H33ClN2O4Si |
| Molecular Weight | 453.06 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | ethyl 1-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-6-chloro-4-oxo-1,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H](CO[Si](C)(C)C(C)(C)C)C(C)C)c2cnc(Cl)cc2c1=O |
| InChI | InChI=1S/C22H33ClN2O4Si/c1-9-28-21(27)16-12-25(17-11-24-19(23)10-15(17)20(16)26)18(14(2)3)13-29-30(7,8)22(4,5)6/h10-12,14,18H,9,13H2,1-8H3/t18-/m1/s1 |
| InChIKey | KUCGEKSEPVYBLZ-GOSISDBHSA-N |
| XLogP | 5.45 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.06 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|