C18H22BNO4 — CID 131748169
ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-4-carboxylate (PubChem CID 131748169) has the molecular formula C18H22BNO4 and a molecular weight of 327.19 g/mol. Its IUPAC name is ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-4-carboxylate.
| Compound Name | ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 131748169 |
| Molecular Formula | C18H22BNO4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C18H22BNO4/c1-6-22-16(21)13-9-10-20-15-8-7-12(11-14(13)15)19-23-17(2,3)18(4,5)24-19/h7-11H,6H2,1-5H3 |
| InChIKey | UHVSBZBECCEHCS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|