C18H27BN2O4 — CID 178093156
ethane;ethyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 178093156) has the molecular formula C18H27BN2O4 and a molecular weight of 346.24 g/mol. Its IUPAC name is ethane;ethyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethane;ethyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 178093156 |
| Molecular Formula | C18H27BN2O4 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | ethane;ethyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CC.CCOC(=O)c1cnc2cc(B3OC(C)(C)C(C)(C)O3)ccn12 |
| InChI | InChI=1S/C16H21BN2O4.C2H6/c1-6-21-14(20)12-10-18-13-9-11(7-8-19(12)13)17-22-15(2,3)16(4,5)23-17;1-2/h7-10H,6H2,1-5H3;1-2H3 |
| InChIKey | WXSXVTAAMBSGHI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|