C13H18BN3O2 — CID 142510516
3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 142510516) has the molecular formula C13H18BN3O2 and a molecular weight of 259.12 g/mol. Its IUPAC name is 3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 142510516 |
| Molecular Formula | C13H18BN3O2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1nnc2cc(B3OC(C)(C)C(C)(C)O3)ccn12 |
| InChI | InChI=1S/C13H18BN3O2/c1-9-15-16-11-8-10(6-7-17(9)11)14-18-12(2,3)13(4,5)19-14/h6-8H,1-5H3 |
| InChIKey | KRYYLEKYTWJTAO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|