C17H21BClN3O2 — CID 70977855
9-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 70977855) has the molecular formula C17H21BClN3O2 and a molecular weight of 345.64 g/mol. Its IUPAC name is 9-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinoline.
| Compound Name | 9-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| PubChem CID | 70977855 |
| Molecular Formula | C17H21BClN3O2 |
| Molecular Weight | 345.64 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 9-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | Cc1nnc2n1-c1c(Cl)cc(B3OC(C)(C)C(C)(C)O3)cc1CC2 |
| InChI | InChI=1S/C17H21BClN3O2/c1-10-20-21-14-7-6-11-8-12(9-13(19)15(11)22(10)14)18-23-16(2,3)17(4,5)24-18/h8-9H,6-7H2,1-5H3 |
| InChIKey | PTNGLVALZZPYNZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|