C21H36B2O4Si — CID 15543911
[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-trimethylsilane (PubChem CID 15543911) has the molecular formula C21H36B2O4Si and a molecular weight of 402.23 g/mol. Its IUPAC name is [3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-trimethylsilane.
| Compound Name | [3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 15543911 |
| Molecular Formula | C21H36B2O4Si |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | [3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-trimethylsilane |
| SMILES | CC1(C)OB(c2cc(B3OC(C)(C)C(C)(C)O3)cc([Si](C)(C)C)c2)OC1(C)C |
| InChI | InChI=1S/C21H36B2O4Si/c1-18(2)19(3,4)25-22(24-18)15-12-16(14-17(13-15)28(9,10)11)23-26-20(5,6)21(7,8)27-23/h12-14H,1-11H3 |
| InChIKey | AJDXLEWIPJOTCT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|