C16H21BO2 — CID 170692995
2-[3,5-bis(ethenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 170692995) has the molecular formula C16H21BO2 and a molecular weight of 256.15 g/mol. Its IUPAC name is 2-[3,5-bis(ethenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3,5-bis(ethenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170692995 |
| Molecular Formula | C16H21BO2 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-[3,5-bis(ethenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=Cc1cc(C=C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H21BO2/c1-7-12-9-13(8-2)11-14(10-12)17-18-15(3,4)16(5,6)19-17/h7-11H,1-2H2,3-6H3 |
| InChIKey | RTYCNSSVEJHTOJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|