C15H21BO3 — CID 59860884
3-prop-2-enyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (PubChem CID 59860884) has the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. Its IUPAC name is 3-prop-2-enyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
| Compound Name | 3-prop-2-enyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
|---|---|
| PubChem CID | 59860884 |
| Molecular Formula | C15H21BO3 |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-prop-2-enyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| SMILES | C=CCc1cc(O)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H21BO3/c1-6-7-11-8-12(10-13(17)9-11)16-18-14(2,3)15(4,5)19-16/h6,8-10,17H,1,7H2,2-5H3 |
| InChIKey | WCWRAJNYADUFCY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|