C16H23BO3 — CID 144775988
3-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 144775988) has the molecular formula C16H23BO3 and a molecular weight of 274.17 g/mol. Its IUPAC name is 3-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 3-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 144775988 |
| Molecular Formula | C16H23BO3 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CCCc1cc(C=O)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H23BO3/c1-6-7-12-8-13(11-18)10-14(9-12)17-19-15(2,3)16(4,5)20-17/h8-11H,6-7H2,1-5H3 |
| InChIKey | DABPAXRCDFGCKF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|