C16H24BO2 — CID 102196608
CID 102196608 (PubChem CID 102196608) has the molecular formula C16H24BO2 and a molecular weight of 259.18 g/mol.
| Compound Name | CID 102196608 |
|---|---|
| PubChem CID | 102196608 |
| Molecular Formula | C16H24BO2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | — |
| SMILES | CCC[CH]c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H24BO2/c1-6-7-8-13-9-11-14(12-10-13)17-18-15(2,3)16(4,5)19-17/h8-12H,6-7H2,1-5H3 |
| InChIKey | QQEVDEDQYBLZCN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|