C15H22BFO4S — CID 123570528
2-[3-fluoro-5-(2-methylsulfonylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123570528) has the molecular formula C15H22BFO4S and a molecular weight of 328.21 g/mol. Its IUPAC name is 2-[3-fluoro-5-(2-methylsulfonylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-fluoro-5-(2-methylsulfonylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123570528 |
| Molecular Formula | C15H22BFO4S |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[3-fluoro-5-(2-methylsulfonylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(F)cc(CCS(C)(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C15H22BFO4S/c1-14(2)15(3,4)21-16(20-14)12-8-11(9-13(17)10-12)6-7-22(5,18)19/h8-10H,6-7H2,1-5H3 |
| InChIKey | LYKLTQOJGIWFHS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|