C19H28BFO4 — CID 158175181
tert-butyl 3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 158175181) has the molecular formula C19H28BFO4 and a molecular weight of 350.24 g/mol. Its IUPAC name is tert-butyl 3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 158175181 |
| Molecular Formula | C19H28BFO4 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | tert-butyl 3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H28BFO4/c1-17(2,3)23-16(22)9-8-13-10-14(12-15(21)11-13)20-24-18(4,5)19(6,7)25-20/h10-12H,8-9H2,1-7H3 |
| InChIKey | FXXMZGNLSMZSFD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|