C22H35BO6 — CID 149301534
tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]butanoate (PubChem CID 149301534) has the molecular formula C22H35BO6 and a molecular weight of 406.33 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 149301534 |
| Molecular Formula | C22H35BO6 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCOc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H35BO6/c1-20(2,3)27-19(24)9-8-14-25-15-16-26-18-12-10-17(11-13-18)23-28-21(4,5)22(6,7)29-23/h10-13H,8-9,14-16H2,1-7H3 |
| InChIKey | XWVSRHGJGOAUTM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|