C33H47BO9 — CID 58479291
2-[3-oxo-6-[2-[3-oxo-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octoxy]ethoxy]hexyl]cyclopent-4-ene-1,3-dione (PubChem CID 58479291) has the molecular formula C33H47BO9 and a molecular weight of 598.54 g/mol. Its IUPAC name is 2-[3-oxo-6-[2-[3-oxo-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octoxy]ethoxy]hexyl]cyclopent-4-ene-1,3-dione.
| Compound Name | 2-[3-oxo-6-[2-[3-oxo-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octoxy]ethoxy]hexyl]cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 58479291 |
| Molecular Formula | C33H47BO9 |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 2-[3-oxo-6-[2-[3-oxo-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octoxy]ethoxy]hexyl]cyclopent-4-ene-1,3-dione |
| SMILES | CC1(C)OB(c2ccc(OCCCCCC(=O)CCOCCOCCCC(=O)CCC3C(=O)C=CC3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C33H47BO9/c1-32(2)33(3,4)43-34(42-32)25-11-14-28(15-12-25)41-21-7-5-6-9-27(36)19-22-40-24-23-39-20-8-10-26(35)13-16-29-30(37)17-18-31(29)38/h11-12,14-15,17-18,29H,5-10,13,16,19-24H2,1-4H3 |
| InChIKey | CDDUFEYLDHIZKA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|